BDBM112170 US8623889, 168
SMILES: CC(C)(CO)Oc1ccc2cc(NC(=O)C3CC3)ncc2c1
InChI Key: InChIKey=TTXRSZTUJKVNSM-UHFFFAOYSA-N
Data: 1 KI
Target/Host (Institution) | Ligand | Target/Host Links | Ligand Links | Trg + Lig Links | Ki nM | ΔG° kcal/mole | IC50 nM | Kd nM | EC50/IC50 nM | koff s-1 | kon M-1s-1 | pH | Temp °C |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Tyrosine-protein kinase ABL1 (Homo sapiens (Human)) | BDBM112170![]() (US8623889, 168) | PDB MMDB Reactome pathway KEGG UniProtKB/SwissProt UniProtKB/TrEMBL B.MOAD DrugBank antibodypedia GoogleScholar | PC cid PC sid UniChem Similars | US Patent | 11 | n/a | n/a | n/a | n/a | n/a | n/a | n/a | n/a |
Genentech Inc US Patent | Assay Description Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos... | US Patent US8623889 (2014) BindingDB Entry DOI: 10.7270/Q2JQ0ZNX | |||||||||||
More data for this Ligand-Target Pair |