BDBM18867 2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy]phenyl}acetic acid::KB-131092::dibromo phenylacetic acid, 11a

SMILES CC(C)c1cc(Oc2c(Br)cc(CC(O)=O)cc2Br)ccc1O

InChI Key InChIKey=FDLOBNTWQDSHPF-UHFFFAOYSA-N

Data  9 IC50  4 EC50

  Tab Delimited (TSV)   2D SDfile   Computed 3D by Vconf -m prep SDfile
Find this compound or compounds like it in BindingDB:
   Substructure
Similarity at least:  must be >=0.5
Exact match

Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB

Found 9 hits for monomerid = 18867   

TargetThyroid hormone receptor alpha(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  1.40nM EC50:  0.380nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  0.0950nM EC50:  0.200nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor alpha(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  1.40nM EC50:  0.380nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  0.0950nM EC50:  0.200nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  0.0955nMAssay Description:Inhibition of thyroid hormone receptor betaMore data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  0.100nMAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta.More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  0.0955nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor alpha(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  1.55nMAssay Description:Inhibition of thyroid hormone receptor alphaMore data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor alpha(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18867(2-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy...)
Affinity DataIC50:  1.40nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed