BDBM18904 2-[3,5-dibromo-4-(cyclohexylmethoxy)phenyl]acetic acid::3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9g
SMILES OC(=O)Cc1cc(Br)c(OCC2CCCCC2)c(Br)c1
InChI Key InChIKey=BNBWGVDBRHRJFJ-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 18904
Affinity DataIC50: 2.70E+3nM EC50: 0.420nMpH: 7.0 T: 2°CAssay Description:IIC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to...More data for this Ligand-Target Pair
Affinity DataIC50: 776nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair
Affinity DataIC50: 770nM EC50: 0.520nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to i...More data for this Ligand-Target Pair