BDBM761292 US20250243186, Example 2
SMILES Cc1cc(C)c2[nH]ccc2c1CN1CCC(CCCO)=CC1c1ccc(C(=O)O)cc1
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 761292
Affinity DataIC50: 60nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 60nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 360nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
