BDBM761296 US20250243186, Example 8
SMILES COc1cc(C)c2[nH]ccc2c1CN1CCC2(CC1c1ccc(C(=O)O)cc1)CC2(F)F
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 761296
Affinity DataIC50: 7nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 245nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
