BDBM761307 US20250243186, Example 27
SMILES COc1cc(C)c2[nH]ccc2c1CN1CCC2(CC1c1ccc(C(=O)O)cc1)CC2F
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 761307
Affinity DataKd: 4.25nMAssay Description:Table 2: Biacore 8 k instrument was primed using 1× PBS-P+ buffer before docking a Cytiva NTA chip. Recombinant human Factor B catalytic domain were ...More data for this Ligand-Target Pair
Affinity DataIC50: 5nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 5.30nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataKd: 6.25nMAssay Description:Table 2: Biacore 8 k instrument was primed using 1× PBS-P+ buffer before docking a Cytiva NTA chip. Recombinant human Factor B catalytic domain were ...More data for this Ligand-Target Pair
