BDBM50119218 4-Benzyloxycarbonylamino-4-[1-(2-hydroxy-5-oxo-tetrahydro-furan-3-ylcarbamoyl)-3-methyl-butylcarbamoyl]-butyric acid::CHEMBL100588
SMILES CC(C)C[C@H](NC(=O)[C@H](CCC(O)=O)NC(=O)OCc1ccccc1)C(=O)N[C@H]1CC(=O)OC1O
InChI Key InChIKey=NETBIBQTHPVZHP-FGJWLUJVSA-N
Data 8 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 8 hits for monomerid = 50119218
Affinity DataIC50: 2.30nMAssay Description:Inhibitory concentration of compound required against Caspase-3 compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 30nMAssay Description:Inhibitory concentration of compound required against Caspase-8 compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 10nMAssay Description:Inhibitory concentration of compound required against Caspase-7 enzyme compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 6.5nMAssay Description:Inhibitory concentration of compound required against Caspase-1 compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 6.5nMAssay Description:Inhibitory concentration of compound required against Caspase-1 enzyme compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 30nMAssay Description:Inhibitory concentration of compound required against Caspase-8 enzyme compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 10nMAssay Description:Inhibitory concentration of compound required against Caspase-7 compared to acylated dipeptidesMore data for this Ligand-Target Pair
Affinity DataIC50: 2.30nMAssay Description:Inhibitory concentration of compound required against Caspase-3 enzyme compared to acylated dipeptidesMore data for this Ligand-Target Pair