Neutrophil elastase
Meas. Tech.
2 M-1s-1
 Alpegiani, MBissolino, PCorigli, RDel Nero, SPerrone, ERizzo, VSacchi, NCassinelli, GFranceschi, GBaici, A Cephem sulfones as inactivators of human leukocyte elastase. 5. 7 alpha-Methoxy- and 7 alpha-chloro-1,1-dioxocephem 4-ketones. J Med Chem 37:4003-19 (1994) [PubMed]  Article
Neutrophil elastase
Bone marrow serine protease | Chymotrypsin | Coagulation factor X | Elastase | Elastase-2 | HLE | Human leukocyte elastase | Leukocyte elastase | Leukocyte elastase (HLE) | Medullasin | Neutrophil elastase | Neutrophil elastase (HNE) | Neutrophil elastase (NE) | PMN elastase | Thrombin | Trypsin
Mol. Mass.:
Homo sapiens (Human)
(S)-7-Methoxy-3-(1-methyl-1H-tetrazol-5-ylsulfanylmethyl)-5,5,8-trioxo-5lambda*6*-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid tert-butyl ester | 7-Methoxy-3-(1-methyl-1H-tetrazol-5-ylsulfanylmethyl)-5,5,8-trioxo-5lambda*6*-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid tert-butyl ester | CHEMBL81892
Small organic molecule
Emp. Form.:
Mol. Mass.:
CO[C@@H]1C2N(C1=O)C(C(=O)OC(C)(C)C)=C(CSc1nnnn1C)CS2(=O)=O |t:15|
Search PDB for entries with ligand similarity: