Target
Chymotrypsinogen B
Ligand
BDBM50133629
Substrate
n/a
Meas. Tech.
ChEMBL_216636
KON
7.6 M-1s-1
Citation
 Iyer, RAHanna, PE N-(carbobenzyloxy)isatin: A slow binding α-keto lactam inhibitor of α-chymotrypsin Bioorg Med Chem Lett 5:89-92 (1995)    Article
Target
Name:
Chymotrypsinogen B
Synonyms:
Beta-chymotrypsin | CTRB1 | Chymotrypsin B chain A | Chymotrypsin B chain B | Chymotrypsin B chain C | Chymotrypsinogen B | Synonyms=CTRB
Type:
PROTEIN
Mol. Mass.:
27713.98
Organism:
Homo sapiens (Human)
Description:
ChEMBL_10909
Residue:
263
Sequence:
MASLWLLSCFSLVGAAFGCGVPAIHPVLSGLSRIVNGEDAVPGSWPWQVSLQDKTGFHFCGGSLISEDWVVTAAHCGVRTSDVVVAGEFDQGSDEENIQVLKIAKVFKNPKFSILTVNNDITLLKLATPARFSQTVSAVCLPSADDDFPAGTLCATTGWGKTKYNANKTPDKLQQAALPLLSNAECKKSWGRRITDVMICAGASGVSSCMGDSGGPLVCQKDGAWTLVGIVSWGSDTCSTSSPGVYARVTKLIPWVQKILAAN
  
Inhibitor
Name:
BDBM50133629
Synonyms:
2,3-Dioxo-2,3-dihydro-indole-1-carboxylic acid benzyl ester | CHEMBL119515
Type:
Small organic molecule
Emp. Form.:
C16H11NO4
Mol. Mass.:
281.2628
SMILES:
O=C(OCc1ccccc1)N1C(=O)C(=O)c2ccccc12
Structure:
Search PDB for entries with ligand similarity: