Details for Substrate BDBM18044 without Explicit Binding Affinity Data | |
| Dihydrofolate reductase |
| Bifunctional dihydrofolate reductase-thymidylate synthase [N51I,C59R,S108N,I164L] |
| Bifunctional dihydrofolate reductase-thymidylate synthase |
| Bifunctional dihydrofolate reductase-thymidylate synthase [1-238,S58R,S117N] |
| Dihydrofolate reductase [F98Y] |
Synonyms: | (2S)-2-[(4-{[(2-amino-4-oxo-1,4,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid | (S)-2-{4-[(2-Amino-4-hydroxy-7,8-dihydro-pteridin-6-ylmethyl)-amino]-benzoylamino}-pentanedioic acid | dihydrofolic acid |
Type: | Small organic molecule |
Emp. Form.: | C19H21N7O6 |
Mol. Mass.: | 443.4133 g/mol |
SMILES: | Nc1nc2NCC(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)=Nc2c(=O)[nH]1 |c:27| |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |