BindingDB logo
myBDB logout

BDBM50013515 (+)-yohimbine::(16alpha,17alpha)-17-hydroxyyohimban-16-carboxylic acid methyl ester::17alpha-hydroxyyohimban-16alpha-carboxylic acid methyl ester::CHEMBL15245::CORYNANTHINE::Johimbin::Quebrachin::RAUWOLSCINE::YOHIMBINE CHLORIDE::Yohimbin::Yohimbine::aphrodine::cid_8969::corynine::methyl 17alpha-hydroxyyohimban-16alpha-carboxylate::quebrachine::yohimbic acid methyl ester

SMILES: COC(=O)[C@H]1[C@@H](O)CC[C@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@H]12

InChI Key: InChIKey=BLGXFZZNTVWLAY-SCYLSFHTSA-N

Data: 285 KI  11 IC50  9 Kd  3 EC50

Find this compound or compounds like it in BindingDB or PDB:
   Substructure
Similarity at least:  must be >=0.5
Exact match