BDBM50160505 1-Benzyl-2-propyl-1H-benzoimidazole-5-sulfonic acid 4-fluoro-benzylamide::CHEMBL179850
SMILES CCCc1nc2cc(ccc2n1Cc1ccccc1)S(=O)(=O)NCc1ccc(F)cc1
InChI Key InChIKey=YEHJVFWSCPFIAC-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 50160505
Affinity DataIC50: >1.00E+4nMAssay Description:Inhibitory concentration of the compound towards rat leutinizing releasing hormone receptorMore data for this Ligand-Target Pair
Affinity DataIC50: >1.00E+4nMAssay Description:Inhibitory concentration of the compound towards human leutinizing releasing hormone receptorMore data for this Ligand-Target Pair