BDBM50160506 CHEMBL427146::N-{2-[1-Benzyl-5-(4-fluoro-benzylsulfamoyl)-1H-benzoimidazol-2-yl]-ethyl}-3,3-dimethyl-butyramide
SMILES CC(C)(C)CC(=O)NCCc1nc2cc(ccc2n1Cc1ccccc1)S(=O)(=O)NCc1ccc(F)cc1
InChI Key InChIKey=JOVBZGLMNXAXTG-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 50160506
Affinity DataIC50: 840nMAssay Description:Inhibitory concentration of the compound towards rat leutinizing releasing hormone receptorMore data for this Ligand-Target Pair
Affinity DataIC50: 2.60E+3nMAssay Description:Inhibitory concentration of the compound towards human leutinizing releasing hormone receptorMore data for this Ligand-Target Pair