BDBM50160513 1-Benzyl-2-{2-[3-(2-chloro-phenyl)-ureido]-ethyl}-1H-benzoimidazole-5-sulfonic acid 4-fluoro-benzylamide::CHEMBL359914
SMILES Fc1ccc(CNS(=O)(=O)c2ccc3n(Cc4ccccc4)c(CCNC(=O)Nc4ccccc4Cl)nc3c2)cc1
InChI Key InChIKey=GCFCORXKMKSJJB-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 50160513
Affinity DataIC50: 83nMAssay Description:Inhibitory concentration of the compound towards human leutinizing releasing hormone receptorMore data for this Ligand-Target Pair
Affinity DataIC50: 50nMAssay Description:Inhibitory concentration of the compound towards rat leutinizing releasing hormone receptorMore data for this Ligand-Target Pair