BDBM50160514 1-Benzyl-2-[2-(3-tert-butyl-ureido)-ethyl]-1H-benzoimidazole-5-sulfonic acid benzylamide::CHEMBL436472
SMILES CC(C)(C)NC(=O)NCCc1nc2cc(ccc2n1Cc1ccccc1)S(=O)(=O)NCc1ccccc1
InChI Key InChIKey=YIUYFBFILWBTCV-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 50160514
Affinity DataIC50: 490nMAssay Description:Inhibitory concentration of the compound towards human leutinizing releasing hormone receptorMore data for this Ligand-Target Pair
Affinity DataIC50: 310nMAssay Description:Inhibitory concentration of the compound towards rat leutinizing releasing hormone receptorMore data for this Ligand-Target Pair