BDBM50160523 1-Benzyl-2-[2-(3-tert-butyl-ureido)-ethyl]-1H-benzoimidazole-5-sulfonic acid 4-chloro-benzylamide::CHEMBL183779
SMILES CC(C)(C)NC(=O)NCCc1nc2cc(ccc2n1Cc1ccccc1)S(=O)(=O)NCc1ccc(Cl)cc1
InChI Key InChIKey=OGVRFODOCMAXSQ-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 50160523
Affinity DataIC50: 3.90nMAssay Description:Inhibitory concentration of the compound towards rat leutinizing releasing hormone receptorMore data for this Ligand-Target Pair
Affinity DataIC50: 4.20nMAssay Description:Inhibitory concentration of the compound towards human leutinizing releasing hormone receptorMore data for this Ligand-Target Pair