BDBM393793 US10597367, Example 82::US9969726, Example 82
SMILES OC(=O)c1cc(ccc1F)-c1ccc(cc1)-c1nc(cc(n1)C(F)(F)F)-c1ccc(nc1)C(F)(F)F
InChI Key InChIKey=KAOFMCAYAKVEQG-UHFFFAOYSA-N
Data 8 EC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 8 hits for monomerid = 393793
TargetMetabotropic glutamate receptor 2(Rat)
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Affinity DataEC50: 490nMAssay Description:Human Embryonic Kidney (HEK-293) cell lines co-expressing rat mGlu receptors 2, 3, 4, 6, 7 or 8 and G protein-coupled inwardly-rectifying potassium (...More data for this Ligand-Target Pair
TargetMetabotropic glutamate receptor 2(Rat)
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Affinity DataEC50: 490nMAssay Description:Human Embryonic Kidney (HEK-293) cell lines co-expressing rat mGlu receptors 2, 3, 4, 6, 7 or 8 and G protein-coupled inwardly-rectifying potassium (...More data for this Ligand-Target Pair
TargetMetabotropic glutamate receptor 5(Rat)
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Affinity DataEC50: 530nMAssay Description:Human Embryonic Kidney (HEK-293) cell lines co-expressing rat mGlu receptors 2, 3, 4, 6, 7 or 8 and G protein-coupled inwardly-rectifying potassium (...More data for this Ligand-Target Pair
Affinity DataEC50: 530nMAssay Description:Human Embryonic Kidney (HEK-293) cell lines co-expressing rat mGlu receptors 2, 3, 4, 6, 7 or 8 and G protein-coupled inwardly-rectifying potassium (...More data for this Ligand-Target Pair
TargetMetabotropic glutamate receptor 5(Rat)
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Affinity DataEC50: 1.32E+3nMAssay Description:Human Embryonic Kidney (HEK-293) cell lines co-expressing rat mGlu receptors 2, 3, 4, 6, 7 or 8 and G protein-coupled inwardly-rectifying potassium (...More data for this Ligand-Target Pair
Affinity DataEC50: 1.32E+3nMAssay Description:Human Embryonic Kidney (HEK-293) cell lines co-expressing rat mGlu receptors 2, 3, 4, 6, 7 or 8 and G protein-coupled inwardly-rectifying potassium (...More data for this Ligand-Target Pair
TargetMetabotropic glutamate receptor 2(Rat)
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Affinity DataEC50: 1.42E+3nMAssay Description:Human Embryonic Kidney (HEK-293) cell lines co-expressing rat mGlu receptors 2, 3, 4, 6, 7 or 8 and G protein-coupled inwardly-rectifying potassium (...More data for this Ligand-Target Pair
TargetMetabotropic glutamate receptor 2(Rat)
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Sanford Burnham Prebys Medical Discovery Institute
US Patent
Affinity DataEC50: 1.42E+3nMAssay Description:Human Embryonic Kidney (HEK-293) cell lines co-expressing rat mGlu receptors 2, 3, 4, 6, 7 or 8 and G protein-coupled inwardly-rectifying potassium (...More data for this Ligand-Target Pair
