BDBM18841 Substituted Acrylate, 6i::propyl 4-(prop-2-enoyloxy)benzoate
SMILES CCCOC(=O)c1ccc(OC(=O)C=C)cc1
InChI Key InChIKey=CYNCOZVAZDIBKD-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 18841
Affinity DataIC50: 6.10E+4nMAssay Description:IC50 is the concentration of each compound required to inhibit 50% of the binding between the TR LBD and the SRC2-2 peptide using fluorescence polari...More data for this Ligand-Target Pair