BDBM112286 US8623889, 284::US8623889, 285
SMILES Cc1ccncc1-c1ccc2cc(NC(=O)C3CC3(F)F)ncc2c1
InChI Key InChIKey=DMUUIELIZUQQGM-UHFFFAOYSA-N
Data 4 KI
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 112286
Affinity DataKi: 0.100nMAssay Description:Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos...More data for this Ligand-Target Pair
Affinity DataKi: 0.100nMAssay Description:Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos...More data for this Ligand-Target Pair
Affinity DataKi: 0.400nMAssay Description:Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos...More data for this Ligand-Target Pair
Affinity DataKi: 0.400nMAssay Description:Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos...More data for this Ligand-Target Pair
