BDBM160051 US10093663, Example 21b::US9682968, Example-21b
SMILES CO[C@@H]1CCN(Cc2c(OC)cc(C)c3[nH]ccc23)[C@H](C1)c1ccc(cc1)C(O)=O
InChI Key InChIKey=MNWOIQKVANULGE-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 160051
Affinity DataIC50: 0.650nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 uM), recombinant human complement factor B (expressed in drosophila cells and purified us...More data for this Ligand-Target Pair
Affinity DataIC50: 650nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
