BDBM232940 US9351973, 9::US9844553, 9
SMILES CCc1c(nn2CCC(=O)N(C)c12)-c1cncc(C)c1
InChI Key InChIKey=LIWBMBBMBQNECH-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 232940
Affinity DataIC50: 7.80nMT: 2°CAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 7.80nMAssay Description:Methods for V79-Human-CYP11B2 and V79-Human-CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme...More data for this Ligand-Target Pair
Affinity DataIC50: 2.34E+3nMAssay Description:Methods for V79-Human-CYP11B2 and V79-Human-CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme...More data for this Ligand-Target Pair
Affinity DataIC50: 2.34E+3nMT: 2°CAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
