BDBM232942 US9351973, 12::US9844553, 12
SMILES CN1c2c(C)c(nn2CCC1=O)-c1cncc(F)c1
InChI Key InChIKey=ZNUSXAVKKIGLRC-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 232942
Affinity DataIC50: 19.1nMT: 2°CAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 19.1nMAssay Description:Methods for V79-Human-CYP11B2 and V79-Human-CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme...More data for this Ligand-Target Pair
Affinity DataIC50: 1.82E+3nMT: 2°CAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 1.82E+3nMAssay Description:Methods for V79-Human-CYP11B2 and V79-Human-CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme...More data for this Ligand-Target Pair
