BDBM232946 US9351973, 26::US9844553, 26
SMILES Clc1cncc(c1)-c1nn2CCC(=O)Nc2c1C#N
InChI Key InChIKey=OHNNVMOHWNKRII-UHFFFAOYSA-N
Data 3 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 232946
Affinity DataIC50: 1.07E+3nMT: 2°CAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 1.07E+3nMAssay Description:Methods for V79-Human-CYP11B2 and V79-Human-CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme...More data for this Ligand-Target Pair
Affinity DataIC50: 51nMAssay Description:Methods for V79-Human-CYP11B2 and V79-Human-CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme...More data for this Ligand-Target Pair