BDBM286334 2-(5-(6-fluoro-[1,2,4] triazolo[1,5-a]pyridin-2- yl)pyridin-3-yl)propan-2- ol::US9567333, 12
SMILES CC(C)(O)c1cncc(c1)-c1nc2ccc(F)cn2n1
InChI Key InChIKey=XPYMFIVAPXJBDJ-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 286334
Affinity DataIC50: 1.07E+3nMAssay Description:CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfectio...More data for this Ligand-Target Pair
Affinity DataIC50: 8.33E+3nMAssay Description:CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfectio...More data for this Ligand-Target Pair
