BDBM286336 2-(5-bromopyridin-3-yl)- 5-methyl-[1,2,4] triazolo[1,5-a]pyridine::US9567333, 13
SMILES Cc1cccc2nc(nn12)-c1cncc(Br)c1
InChI Key InChIKey=MMDMHYBJKAJHMX-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 286336
Affinity DataIC50: 884nMAssay Description:CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfectio...More data for this Ligand-Target Pair
Affinity DataIC50: 8.33E+3nMAssay Description:CYP11B1 Assays: V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfectio...More data for this Ligand-Target Pair
