BDBM50030155 Arg-Pro-Lys-Pro-Gln-Gln-deltaZPhe-Phe-Gly-Leu-Met::CHEMBL264341::CHEMBL265573
SMILES CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)C(NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCNC(N)=N)=Cc1ccccc1)C(N)=O
InChI Key InChIKey=DDMOCKJMEBSACV-UHFFFAOYSA-N
Data 6 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 6 hits for monomerid = 50030155
Affinity DataIC50: 63nMAssay Description:Concentration required to inhibit the specific binding of [125I]BH-SP to Neurokinin-1 (NK-1) receptor in rat brain synaptosomesMore data for this Ligand-Target Pair
Affinity DataIC50: 950nMAssay Description:Concentration required to inhibit the specific binding of [125I]NKA to Neurokinin-2 (NK-2) receptor in rat duodenum membranesMore data for this Ligand-Target Pair
Affinity DataIC50: 2.70E+3nMAssay Description:Concentration required to inhibit the specific binding of [125I]BH-SP to Neurokinin-1 (NK-1) receptor in rat brain synaptosomesMore data for this Ligand-Target Pair
Affinity DataIC50: 4.90E+3nMAssay Description:Concentration required to inhibit the specific binding of [125I]NKA to Neurokinin-2 (NK-2) receptor in rat duodenum membranesMore data for this Ligand-Target Pair
Affinity DataIC50: 1.00E+4nMAssay Description:Concentration required to inhibit the specific binding of [125I]BH-ELE to Neurokinin-3 (NK-3) receptor in rat brain synaptosomesMore data for this Ligand-Target Pair
Affinity DataIC50: 1.17E+4nMAssay Description:Concentration required to inhibit the specific binding of [125I]BH-ELE to Neurokinin-3 (NK-3) receptor in rat brain synaptosomesMore data for this Ligand-Target Pair
