BDBM562465 US11401295, Compound 4C
SMILES [BH3-][P@@]1(=O)OC[C@H]2O[C@H](C(F)[C@H]2O[P@@]([S-])(=O)OC[C@H]2O[C@H]([C@@H](F)C2O1)n1cnc2c(N)ncnc12)n1cnc2c(N)ncnc12
InChI Key InChIKey=ORUHEVCLXKFUOD-UHFFFAOYSA-M
Data 1 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 562465
TargetStimulator of interferon genes protein [140-379](Mountain lion)
Shanghai Jemincare Pharmaceuticals
US Patent
Shanghai Jemincare Pharmaceuticals
US Patent
Affinity DataIC50: 1.44E+3nMAssay Description:Fluorescence polarization assay (FP assay) was used to detect the affinity of compounds for human STING proteins. There were a certain amount of fluo...More data for this Ligand-Target Pair
