BDBM707841 US20240417410, Example 29
SMILES CO[C@@H](C)c1ncc(N2CCN(C)CC2)cc1-c1c2c3cc(cc4c3n1CCC4)-c1csc(n1)C[C@H](NC(=O)[C@H]1C[C@@H]1c1ccccc1F)C(=O)N1CCC[C@H](N1)C(=O)OCC(C)(C)C2
InChI Key InChIKey=DZZYIEBXVZLARP-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 707841
TargetGTPase KRas [G12C]/Serine/threonine-protein kinase B-raf/Peptidyl-prolyl cis-trans isomerase A(Human)
Hoffmann-La Roche
US Patent
Hoffmann-La Roche
US Patent
Affinity DataIC50: 12.7nMAssay Description:In this example, TR-FRET was also used to measure the compound or compound-CYPA dependent disruption of the KRAS G12C-BRAF complex. This protocol was...More data for this Ligand-Target Pair
TargetGTPase KRas [G12V]/Serine/threonine-protein kinase B-raf/Peptidyl-prolyl cis-trans isomerase A(Human)
Hoffmann-La Roche
US Patent
Hoffmann-La Roche
US Patent
Affinity DataIC50: 8.90E+3nMAssay Description:In this example, TR-FRET was also used to measure the compound or compound-CYPA dependent disruption of the KRAS G12C-BRAF complex. This protocol was...More data for this Ligand-Target Pair
TargetGTPase KRas [G12D]/Serine/threonine-protein kinase B-raf/Peptidyl-prolyl cis-trans isomerase A(Human)
Hoffmann-La Roche
US Patent
Hoffmann-La Roche
US Patent
Affinity DataIC50: 6.62E+4nMAssay Description:In this example, TR-FRET was also used to measure the compound or compound-CYPA dependent disruption of the KRAS G12C-BRAF complex. This protocol was...More data for this Ligand-Target Pair
