BDBM730267 US20250109139, Compound I-A15
SMILES COc1cccc2c3c(oc12)CN(CCNC(=O)C1CCC(F)(F)CC1)CC3
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 730267
Affinity DataKi: 5.43nMAssay Description:Table 3: In the first step, a cell membrane component containing specific 5-HT1A receptors was prepared. A 10 cm culture dish with HEK-293T cells was...More data for this Ligand-Target Pair
Affinity DataKi: 272nMAssay Description:Table 1: In the first step, a cell membrane component containing specific dopamine D2 receptors was prepared. A 10 cm culture dish was used for trans...More data for this Ligand-Target Pair
