BDBM751486 US20250197363, Example 25
SMILES Cc3cc(SCc2nnc(c1ccc(OC(F)(F)F)cc1)s2)ccc3OCC(=O)O
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 751486
Affinity DataEC50: 42nMAssay Description:In order to confirm the PPARĪ“ activation effect of the example compounds, the following experiment was performed. First, the example compounds were d...More data for this Ligand-Target Pair
