BDBM757831 US20250230138, Compound 37
SMILES COCCOc1cc(F)ccc1-c1c(-c2cnn(CCC(=O)NC(C)(C)C)c2)nc(-c2ccc3c(c2)CCNC3=O)c2ccsc12
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 757831
TargetGTPase KRAS/Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform(Human)
TheRas
US Patent
TheRas
US Patent
Affinity DataIC50: 1.50E+4nMAssay Description:SPR binding experiments were collected on a Biacore 8K Instrument (Cytiva). Neutravidin (Pierce) was amine coupled to the carboxymethylated dextran s...More data for this Ligand-Target Pair
