BDBM761316 CHEM-US-00368 4-(5-(difluoromethyl)-2-((5- methoxy-7-methyl-1H-indol-4- yl)methyl)octahydrocyclopenta [c]pyrrol-1-yl)benzoic acid::US20250243186, Example 39
SMILES COc1cc(C(=O)O)c2[nH]ccc2c1CN1CC2CC(C(F)F)CC2C1c1ccccc1
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 761316
Affinity DataIC50: 2.60nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 7.30nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 7.30nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
