BDBM761317 US20250243186, Example 40
SMILES COc1cc(C)c2[nH]ccc2c1CN1CCC2(CC(F)C2)CC1c1ccc(C(=O)O)cc1
InChI Key InChIKey=DLYGQHUDZJIJKG-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 761317
Affinity DataIC50: 1.80nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
Affinity DataIC50: 3nMAssay Description:Table 1: Factor B binding affinity of each compound tested was determined using a time-resolved fluorescence resonance energy transfer (TR-FRET) tech...More data for this Ligand-Target Pair
