BDBM150722 4‐bromo‐2‐[(3‐chlorophenyl)carbamoyl]phenyl diethyl phosphate (2)
SMILES CCOP(=O)(OCC)Oc1ccc(Br)cc1C(=O)Nc1cccc(Cl)c1
InChI Key InChIKey=ATJJNWQFYXZMNI-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 150722
Affinity DataIC50: 2.44E+4nMAssay Description:The reaction mixture containing phosphate buffer, AChE or BChE and chosen compounds was prepared and intensively stirred. In given times (5, 10, 15, ...More data for this Ligand-Target Pair
Affinity DataIC50: 7.99E+4nMAssay Description:The reaction mixture containing phosphate buffer, AChE or BChE and chosen compounds was prepared and intensively stirred. In given times (5, 10, 15, ...More data for this Ligand-Target Pair
