BDBM17337 3-({2-[6-(dimethylamino)naphthalen-2-yl]-2-oxoethyl}sulfanyl)-2-({1-[2-(1-formamidoethan-1-aminium)-3-methylbutanoyl]pyrrolidin-2-yl}formamido)propanoate::AVPC-BADAN

SMILES CC(C)C(NC(=O)C(C)[NH3+])C(=O)N1CCCC1C(=O)NC(CSCC(=O)c1ccc2cc(ccc2c1)N(C)C)C([O-])=O

InChI Key InChIKey=HNTONTWKIRYPLG-UHFFFAOYSA-N

Find this compound or compounds like it in BindingDB:
   Substructure
Similarity at least:  must be >=0.5
Exact match