BDBM258743 US9499482, 142
SMILES COc1cc(ccc1OCCN1CCCC1)N1CC=C(Oc2ccc(cc2)C2CC2)C1=O
InChI Key InChIKey=NDQYSDBXPKTXCY-UHFFFAOYSA-N
Data 1 KI
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 258743
Affinity DataKi: 0.700nMpH: 7.4Assay Description:An in vitro binding assay was used to determine the compound Ki value or ability to antagonize binding of a peptide agonist to the human melanin conc...More data for this Ligand-Target Pair
