BDBM50280655 3-Isobutyryloxy-benzo[4,5]thieno[3,2-b]furan-2-carboxylic acid methyl ester::CHEMBL268367
SMILES COC(=O)c1oc2c(sc3ccccc23)c1OC(=O)C(C)C
InChI Key InChIKey=STCBJZIZCOASHY-UHFFFAOYSA-N
Data 5 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 50280655
Affinity DataIC50: 100nMAssay Description:In vitro concentration of compound required to inhibit 50% of Factor XaMore data for this Ligand-Target Pair
Affinity DataIC50: 2.90E+4nMAssay Description:In vitro concentration of compound required to inhibit 50% of trypsinMore data for this Ligand-Target Pair
Affinity DataIC50: 2.40E+5nMAssay Description:In vitro concentration of compound required to inhibit 50% of PlasminMore data for this Ligand-Target Pair
Affinity DataIC50: 30nMAssay Description:In vitro concentration of compound required to inhibit 50% of 6 nM thrombinMore data for this Ligand-Target Pair
Affinity DataIC50: 7.20E+3nMAssay Description:In vitro concentration of compound required to inhibit 50% of KallikreinMore data for this Ligand-Target Pair