BDBM595668 US11591328, Compound 21
SMILES Cn1cc(cn1)-c1cc(Oc2ccc(NC(=O)N3CCC4(CCC(F)(F)C4)C3=O)nc2)ccn1
InChI Key InChIKey=YESKHRZGFKDGEH-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 595668
TargetMacrophage colony-stimulating factor 1 receptor(Homo sapiens (Human))
Xiamen Biotime Biotechnology
US Patent
Xiamen Biotime Biotechnology
US Patent
Affinity DataIC50: 2.80nMAssay Description:CSF1R: The specific operation is as follows: Set the concentration gradient of the test compound and dilute the test compound to the working concentr...More data for this Ligand-Target Pair
TargetPlatelet-derived growth factor receptor beta(Homo sapiens (Human))
Xiamen Biotime Biotechnology
US Patent
Xiamen Biotime Biotechnology
US Patent
Affinity DataIC50: 7.45E+3nMAssay Description:c-Kit, PDGFRα, PDGFRβ, FLT-3:Add 5 μL of compound (10% DMSO) at 5 times the final concentration of the reaction to a 384-well plate. A...More data for this Ligand-Target Pair
TargetPlatelet-derived growth factor receptor alpha(Homo sapiens (Human))
Xiamen Biotime Biotechnology
US Patent
Xiamen Biotime Biotechnology
US Patent
Affinity DataIC50: 43nMAssay Description:c-Kit, PDGFRα, PDGFRβ, FLT-3:Add 5 μL of compound (10% DMSO) at 5 times the final concentration of the reaction to a 384-well plate. A...More data for this Ligand-Target Pair
TargetMast/stem cell growth factor receptor Kit(Homo sapiens (Human))
Xiamen Biotime Biotechnology
US Patent
Xiamen Biotime Biotechnology
US Patent
Affinity DataIC50: 10.1nMAssay Description:c-Kit, PDGFRα, PDGFRβ, FLT-3:Add 5 μL of compound (10% DMSO) at 5 times the final concentration of the reaction to a 384-well plate. A...More data for this Ligand-Target Pair