BDBM609729 DOTA[(Gd(III)]- HyBz-D-Ala- boroPro::US11707539, Compound 5183
SMILES C[C@@H](NC(=O)c1ccc(NNC(=O)CN2CCN3CCN4CCN(CC2)CC(=O)O[Gd](OC(=O)C3)OC(=O)C4)cc1)C(=O)N1CCC[C@H]1B(O)O
InChI Key InChIKey=ZHPLOOABVYXWII-UHFFFAOYSA-K
Data 3 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 609729
Affinity DataIC50: 5.30nMAssay Description:The purpose of this assay is to determine the IC50 of various inhibitors against recombinant human dipeptidyl peptidase IV (DPPIV), fibroblast activa...More data for this Ligand-Target Pair
Affinity DataIC50: 68nMAssay Description:The purpose of this assay is to determine the IC50 of various inhibitors against recombinant human dipeptidyl peptidase IV (DPPIV), fibroblast activa...More data for this Ligand-Target Pair
Affinity DataIC50: 910nMAssay Description:The purpose of this assay is to determine the IC50 of various inhibitors against recombinant human dipeptidyl peptidase IV (DPPIV), fibroblast activa...More data for this Ligand-Target Pair
