Details for Substrate BDBM11326 without Explicit Binding Affinity Data | |
| Carbonic anhydrase 6 |
| Carbonic anhydrase 4 |
| Carbonic anhydrase 2 |
| Carbonic anhydrase 1 |
Synonyms: | 4-nitrophenyl acetate | p-Nitrophenyl Acetate |
Type: | Small organic molecule |
Emp. Form.: | C8H7NO4 |
Mol. Mass.: | 181.1455 g/mol |
SMILES: | CC(=O)Oc1ccc(cc1)[N+]([O-])=O |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |