Details for Substrate BDBM22111 without Explicit Binding Affinity Data | |
| 5'-methylthioadenosine/S-adenosylhomocysteine nucleosidase |
| S-methyl-5'-thioadenosine phosphorylase |
| Adenosylhomocysteine nucleosidase |
Synonyms: | (2R,3R,4S,5S)-2-(6-amino-9H-purin-9-yl)-5-[(methylsulfanyl)methyl]oxolane-3,4-diol | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol | 5'-Methylthioado | 5-methylthioadenosine | CHEMBL277041 | MTA |
Type: | Nucleoside or nucleotide |
Emp. Form.: | C11H15N5O3S |
Mol. Mass.: | 297.334 g/mol |
SMILES: | CSC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(N)ncnc12 |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |