Details for Substrate BDBM35847 without Explicit Binding Affinity Data | |
| Prostaglandin E2 receptor EP2 subtype |
| Prostaglandin E2 receptor EP1 subtype |
| Prostaglandin E2 receptor EP3 subtype |
| Prostaglandin E2 receptor EP4 subtype |
Synonyms: | (15S)-prostaglandin E2 | (5Z,11alpha,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid | (5Z,13E,15S)-11alpha,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid | (E,Z)-(1R,2R,3R)-7-(3-Hydroxy-2-((3S)-(3-hydroxy-1-octenyl))-5-oxocyclopentyl)-5-heptenoic acid | CHEMBL548 | DINOPROSTONE | PGE2 | [3H]Dinoprostone | [3H]PGE2 | [3H]Prostaglandin E2 | prostaglandin E2 |
Type: | radiolabeled ligand |
Emp. Form.: | C20H32O5 |
Mol. Mass.: | 352.4651 g/mol |
SMILES: | CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |