BDBM558465 2-[2-Fluoro-3-[[6-(1H-pyrazol-5-yl)pyridin-3-yl]oxymethyl]phenyl]cyclopropane-1-carboxylic Acid::US11365192, Example 70-3::US11365192, Example 71-45::US11365192, Example 71-46
SMILES OC(=O)C1CC1c1cccc(COc2ccc(nc2)-c2ccn[nH]2)c1F
InChI Key InChIKey=MAEXTXDEMKSWAF-UHFFFAOYSA-N
Data 6 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 6 hits for monomerid = 558465
Affinity DataIC50: 15nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair
Affinity DataIC50: 19nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair
Affinity DataIC50: 28nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair
Affinity DataIC50: 210nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair
Affinity DataIC50: 240nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair
Affinity DataIC50: 280nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair
