BDBM112058 US8623889, 56
SMILES Cc1ccc(F)cc1-c1ccc2cc(NC(=O)C3C[C@H]3F)ncc2c1
InChI Key InChIKey=IWFDVJZHUXISJH-QRWMCTBCSA-N
Data 2 KI
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 112058
Affinity DataKi: 0.0900nMAssay Description:Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos...More data for this Ligand-Target Pair
Affinity DataKi: 0.100nMAssay Description:Using the following procedure, varying concentration of compounds of the invention were assessed for their ability to inhibit c-Abl enzyme's phos...More data for this Ligand-Target Pair