BDBM159841 US10093663, Example 17-22::US9682968, Example-17-22
SMILES COc1cc(C)c2[nH]ccc2c1CN1CCCCCC1c1ccc(cc1)C(O)=O
InChI Key
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 159841
Affinity DataIC50: 100nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 0.100nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair