BDBM251408 US9452990, 90
SMILES CCN[C@H](CC(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)c(F)c2n1)c1ccc(cc1)C#N
InChI Key InChIKey=FQQPKJKIBNLDSF-LJQANCHMSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 251408
Affinity DataIC50: 1nMAssay Description:Inhibition of recombinant human factor B expressed in drosophila cells assessed as decrease in C3a formation using CVF-Bb complex and human complemen...More data for this Ligand-Target Pair
TargetCobra venom factor/Complement factor B/Complement factor D(Naja kaouthia (Monocled cobra) (Naja siamensis))
Novartis
US Patent
Novartis
US Patent
Affinity DataIC50: 1nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair