BDBM458826 6-((1,1-Dioxidotetrahydro-2H-thiopyran-4-yl)(ethyl)amino)-5-ethyl-N-((4-methoxy-6-m ethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)benzofuran-4-carboxamide 33::US10759787, Example 33::US11059811, Example 33
SMILES CCN(C1CCS(=O)(=O)CC1)c1cc2occc2c(C(=O)NCc2c(OC)cc(C)[nH]c2=O)c1CC
InChI Key InChIKey=BBYQHSXYFOJHRK-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 458826
TargetHistone-lysine N-methyltransferase EZH2 [A677G](Homo sapiens (Human))
Jiangsu Hengrui Medicine
US Patent
Jiangsu Hengrui Medicine
US Patent
Affinity DataIC50: 2.70nMAssay Description:The activity of EZH2 enzyme (with A677G mutant or Y641F mutant) was tested by the following method.The method was used to determine the inhibitory ef...More data for this Ligand-Target Pair
TargetHistone-lysine N-methyltransferase EZH2 [Y641F](Homo sapiens (Human))
Jiangsu Hengrui Medicine
US Patent
Jiangsu Hengrui Medicine
US Patent
Affinity DataIC50: 0.800nMAssay Description:The activity of EZH2 enzyme (with A677G mutant or Y641F mutant) was tested by the following method.The method was used to determine the inhibitory ef...More data for this Ligand-Target Pair
TargetHistone-lysine N-methyltransferase EZH2 [A677G](Homo sapiens (Human))
Jiangsu Hengrui Medicine
US Patent
Jiangsu Hengrui Medicine
US Patent
Affinity DataIC50: 2.70nMAssay Description:The activity of EZH2 enzyme (with A677G mutant or Y641F mutant) was tested by the following method.The method was used to determine the inhibitory ef...More data for this Ligand-Target Pair
TargetHistone-lysine N-methyltransferase EZH2 [Y641F](Homo sapiens (Human))
Jiangsu Hengrui Medicine
US Patent
Jiangsu Hengrui Medicine
US Patent
Affinity DataIC50: 0.800nMAssay Description:The activity of EZH2 enzyme (with A677G mutant or Y641F mutant) was tested by the following method.The method was used to determine the inhibitory ef...More data for this Ligand-Target Pair