BDBM50123431 7-{7-[1-(1-Imino-ethyl)-piperidin-4-yloxy]-3-oxo-2,3-dihydro-benzo[1,4]oxazin-4-ylmethyl}-naphthalene-2-carboxamidine::CHEMBL153640
SMILES CC(=N)N1CCC(CC1)Oc1ccc2N(Cc3ccc4ccc(cc4c3)C(N)=N)C(=O)COc2c1
InChI Key InChIKey=YHLBLXQXZYNNKM-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 50123431
Affinity DataKi: 0.780nMAssay Description:Binding affinity of the compound towards factor XaMore data for this Ligand-Target Pair
Affinity DataIC50: 6nMAssay Description:Inhibitory concentration of the compound to factor XaMore data for this Ligand-Target Pair
Affinity DataIC50: >1.00E+4nMAssay Description:Inhibitory concentration of the compound against factor IIaMore data for this Ligand-Target Pair
Affinity DataIC50: 28nMAssay Description:Inhibitory concentration of the compound against trypsinMore data for this Ligand-Target Pair