BDBM562458 US11401295, Compound 3A
SMILES B[P@@]1(=O)OC[C@H]2O[C@H]([C@@H](F)C2O[P@](B)(=O)OC[C@H]2O[C@H]([C@@H](O)C2O1)n1cc(F)c2c1nc[nH]c2=O)n1cnc2c(N)ncnc12
InChI Key
Data 1 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 562458
TargetStimulator of interferon genes protein [140-379](Homo sapiens (Human))
Shanghai Jemincare Pharmaceuticals
US Patent
Shanghai Jemincare Pharmaceuticals
US Patent
Affinity DataIC50: 5.91E+3nMAssay Description:Fluorescence polarization assay (FP assay) was used to detect the affinity of compounds for human STING proteins. There were a certain amount of fluo...More data for this Ligand-Target Pair