BDBM592506 US11572371, Compound 6
SMILES CCOCc1nnc(CC2N=C(c3c(C)c(C)sc3-n3c(C)nnc23)c2ccc(Cl)cc2)o1
InChI Key InChIKey=USNVRJYSAUJTNT-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 592506
Affinity DataIC50: 15nMAssay Description:Homogeneous time=resolved fluorescence (HTRF) was used to detect the binding of the compound to BRD4(D1 + D2) and BRDT (D1) proteins, and the AlphaSc...More data for this Ligand-Target Pair
Affinity DataIC50: 46nMAssay Description:Homogeneous time=resolved fluorescence (HTRF) was used to detect the binding of the compound to BRD4(D1 + D2) and BRDT (D1) proteins, and the AlphaSc...More data for this Ligand-Target Pair
Affinity DataIC50: 20nMAssay Description:Homogeneous time=resolved fluorescence (HTRF) was used to detect the binding of the compound to BRD4(D1 + D2) and BRDT (D1) proteins, and the AlphaSc...More data for this Ligand-Target Pair
Affinity DataIC50: 27nMAssay Description:Homogeneous time=resolved fluorescence (HTRF) was used to detect the binding of the compound to BRD4(D1 + D2) and BRDT (D1) proteins, and the AlphaSc...More data for this Ligand-Target Pair